C14H19NO3 — CID 12775367
N-[(4S,5S,6R)-5,6-dihydroxyhept-1-en-4-yl]benzamide (PubChem CID 12775367) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-[(4S,5S,6R)-5,6-dihydroxyhept-1-en-4-yl]benzamide.
| Compound Name | N-[(4S,5S,6R)-5,6-dihydroxyhept-1-en-4-yl]benzamide |
|---|---|
| PubChem CID | 12775367 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | N-[(4S,5S,6R)-5,6-dihydroxyhept-1-en-4-yl]benzamide |
| SMILES | C=CC[C@H](NC(=O)c1ccccc1)[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C14H19NO3/c1-3-7-12(13(17)10(2)16)15-14(18)11-8-5-4-6-9-11/h3-6,8-10,12-13,16-17H,1,7H2,2H3,(H,15,18)/t10-,12+,13-/m1/s1 |
| InChIKey | CMSHDDZAWRPFCI-KGYLQXTDSA-N |
| XLogP | 1.10 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|