C16H16ClNO4 — CID 175045736
3-benzamido-2-hydroxy-3-phenylpropanoic acid;hydrochloride (PubChem CID 175045736) has the molecular formula C16H16ClNO4 and a molecular weight of 321.76 g/mol. Its IUPAC name is 3-benzamido-2-hydroxy-3-phenylpropanoic acid;hydrochloride.
| Compound Name | 3-benzamido-2-hydroxy-3-phenylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 175045736 |
| Molecular Formula | C16H16ClNO4 |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-benzamido-2-hydroxy-3-phenylpropanoic acid;hydrochloride |
| SMILES | Cl.O=C(NC(c1ccccc1)C(O)C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H15NO4.ClH/c18-14(16(20)21)13(11-7-3-1-4-8-11)17-15(19)12-9-5-2-6-10-12;/h1-10,13-14,18H,(H,17,19)(H,20,21);1H |
| InChIKey | PTCRSTKFEPWGTG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |