C16H15NO3S — CID 18660976
(2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanethioic S-acid (PubChem CID 18660976) has the molecular formula C16H15NO3S and a molecular weight of 301.37 g/mol. Its IUPAC name is (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanethioic S-acid.
| Compound Name | (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanethioic S-acid |
|---|---|
| PubChem CID | 18660976 |
| Molecular Formula | C16H15NO3S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.08 |
| IUPAC Name | (2S,3R)-3-benzamido-2-hydroxy-3-phenylpropanethioic S-acid |
| SMILES | O=C(N[C@H](c1ccccc1)[C@H](O)C(=O)S)c1ccccc1 |
| InChI | InChI=1S/C16H15NO3S/c18-14(16(20)21)13(11-7-3-1-4-8-11)17-15(19)12-9-5-2-6-10-12/h1-10,13-14,18H,(H,17,19)(H,20,21)/t13-,14+/m1/s1 |
| InChIKey | FRZFZWLPGNQPNV-KGLIPLIRSA-N |
| XLogP | 1.98 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|