C16H18O — CID 166439857
(2R,3S)-3,4-diphenylbutan-2-ol (PubChem CID 166439857) has the molecular formula C16H18O and a molecular weight of 226.32 g/mol. Its IUPAC name is (2R,3S)-3,4-diphenylbutan-2-ol.
| Compound Name | (2R,3S)-3,4-diphenylbutan-2-ol |
|---|---|
| PubChem CID | 166439857 |
| Molecular Formula | C16H18O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | (2R,3S)-3,4-diphenylbutan-2-ol |
| SMILES | C[C@@H](O)[C@@H](Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H18O/c1-13(17)16(15-10-6-3-7-11-15)12-14-8-4-2-5-9-14/h2-11,13,16-17H,12H2,1H3/t13-,16-/m1/s1 |
| InChIKey | PLTSKMDMOAQEKI-CZUORRHYSA-N |
| XLogP | 3.39 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |