C19H26O — CID 66739341
4,6-dimethylnona-1,8-dien-5-one;styrene (PubChem CID 66739341) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is 4,6-dimethylnona-1,8-dien-5-one;styrene.
| Compound Name | 4,6-dimethylnona-1,8-dien-5-one;styrene |
|---|---|
| PubChem CID | 66739341 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | 4,6-dimethylnona-1,8-dien-5-one;styrene |
| SMILES | C=CCC(C)C(=O)C(C)CC=C.C=Cc1ccccc1 |
| InChI | InChI=1S/C11H18O.C8H8/c1-5-7-9(3)11(12)10(4)8-6-2;1-2-8-6-4-3-5-7-8/h5-6,9-10H,1-2,7-8H2,3-4H3;2-7H,1H2 |
| InChIKey | IGKQCARVZJNMBB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|