About (2R)-2-methyl-N,N-diphenylpent-4-enamide
(2R)-2-methyl-N,N-diphenylpent-4-enamide (PubChem CID 24809395) has the molecular formula C18H19NO
and a molecular weight of 265.36 g/mol. Its IUPAC name is (2R)-2-methyl-N,N-diphenylpent-4-enamide.
Molecular Properties
| Compound Name | (2R)-2-methyl-N,N-diphenylpent-4-enamide |
| PubChem CID | 24809395 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (2R)-2-methyl-N,N-diphenylpent-4-enamide |
| SMILES | C=CC[C@@H](C)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO/c1-3-10-15(2)18(20)19(16-11-6-4-7-12-16)17-13-8-5-9-14-17/h3-9,11-15H,1,10H2,2H3/t15-/m1/s1 |
| InChIKey | SRPCCQAAOINZPP-OAHLLOKOSA-N |
| XLogP | 4.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-methyl-N,N-diphenylpent-4-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-methyl-N,N-diphenylpent-4-enamide?
The IUPAC name of (2R)-2-methyl-N,N-diphenylpent-4-enamide (CID 24809395) is (2R)-2-methyl-N,N-diphenylpent-4-enamide.
What is the SMILES notation for (2R)-2-methyl-N,N-diphenylpent-4-enamide?
The canonical SMILES for (2R)-2-methyl-N,N-diphenylpent-4-enamide is C=CC[C@@H](C)C(=O)N(c1ccccc1)c1ccccc1.
What is the InChIKey of (2R)-2-methyl-N,N-diphenylpent-4-enamide?
The InChIKey is SRPCCQAAOINZPP-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H19NO/c1-3-10-15(2)18(20)19(16-11-6-4-7-12-16)17-13-8-5-9-14-17/h3-9,11-15H,1,10H2,2H3/t15-/m1/s1.
What are the key properties of (2R)-2-methyl-N,N-diphenylpent-4-enamide?
(2R)-2-methyl-N,N-diphenylpent-4-enamide has a molecular weight of 265.36 g/mol, XLogP of 4.56, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-methyl-N,N-diphenylpent-4-enamide is sourced from PubChem (CID 24809395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).