C24H31NO2 — CID 101487934
(2R)-2-methyl-4-oxo-N,N-diphenylundecanamide (PubChem CID 101487934) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (2R)-2-methyl-4-oxo-N,N-diphenylundecanamide.
| Compound Name | (2R)-2-methyl-4-oxo-N,N-diphenylundecanamide |
|---|---|
| PubChem CID | 101487934 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (2R)-2-methyl-4-oxo-N,N-diphenylundecanamide |
| SMILES | CCCCCCCC(=O)C[C@@H](C)C(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-3-4-5-6-13-18-23(26)19-20(2)24(27)25(21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17,20H,3-6,13,18-19H2,1-2H3/t20-/m1/s1 |
| InChIKey | XIXPGIQMHDBFSY-HXUWFJFHSA-N |
| XLogP | 6.31 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|