C19H26N2O3 — CID 77475220
tert-butyl N-[1-oxo-1-(N-prop-2-enylanilino)pent-4-en-2-yl]carbamate (PubChem CID 77475220) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is tert-butyl N-[1-oxo-1-(N-prop-2-enylanilino)pent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-oxo-1-(N-prop-2-enylanilino)pent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 77475220 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | tert-butyl N-[1-oxo-1-(N-prop-2-enylanilino)pent-4-en-2-yl]carbamate |
| SMILES | C=CCC(NC(=O)OC(C)(C)C)C(=O)N(CC=C)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O3/c1-6-11-16(20-18(23)24-19(3,4)5)17(22)21(14-7-2)15-12-9-8-10-13-15/h6-10,12-13,16H,1-2,11,14H2,3-5H3,(H,20,23) |
| InChIKey | IQRLXZUKWCOXSG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|