C18H27NO2 — CID 141150308
tert-butyl N-(4-phenylhept-6-en-2-yl)carbamate (PubChem CID 141150308) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is tert-butyl N-(4-phenylhept-6-en-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-phenylhept-6-en-2-yl)carbamate |
|---|---|
| PubChem CID | 141150308 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | tert-butyl N-(4-phenylhept-6-en-2-yl)carbamate |
| SMILES | C=CCC(CC(C)NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H27NO2/c1-6-10-16(15-11-8-7-9-12-15)13-14(2)19-17(20)21-18(3,4)5/h6-9,11-12,14,16H,1,10,13H2,2-5H3,(H,19,20) |
| InChIKey | GPCOOLVOMHOOCI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|