C16H25NO3 — CID 97086612
tert-butyl N-[(2S,4R)-4-hydroxy-2-phenylpentyl]carbamate (PubChem CID 97086612) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is tert-butyl N-[(2S,4R)-4-hydroxy-2-phenylpentyl]carbamate.
| Compound Name | tert-butyl N-[(2S,4R)-4-hydroxy-2-phenylpentyl]carbamate |
|---|---|
| PubChem CID | 97086612 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | tert-butyl N-[(2S,4R)-4-hydroxy-2-phenylpentyl]carbamate |
| SMILES | C[C@@H](O)C[C@H](CNC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H25NO3/c1-12(18)10-14(13-8-6-5-7-9-13)11-17-15(19)20-16(2,3)4/h5-9,12,14,18H,10-11H2,1-4H3,(H,17,19)/t12-,14-/m1/s1 |
| InChIKey | YQEIZJSTYNVLIR-TZMCWYRMSA-N |
| XLogP | 3.07 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |