C16H27ClN2O2 — CID 119821967
N-(4-hydroxy-2-phenylpentyl)-4-(methylamino)butanamide;hydrochloride (PubChem CID 119821967) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is N-(4-hydroxy-2-phenylpentyl)-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-(4-hydroxy-2-phenylpentyl)-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119821967 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | N-(4-hydroxy-2-phenylpentyl)-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NCC(CC(C)O)c1ccccc1.Cl |
| InChI | InChI=1S/C16H26N2O2.ClH/c1-13(19)11-15(14-7-4-3-5-8-14)12-18-16(20)9-6-10-17-2;/h3-5,7-8,13,15,17,19H,6,9-12H2,1-2H3,(H,18,20);1H |
| InChIKey | ZRUKPMPOQPDCPL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|