C16H21NO3 — CID 110004037
N-(4-hydroxy-2-phenylpentyl)-3-oxocyclobutane-1-carboxamide (PubChem CID 110004037) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(4-hydroxy-2-phenylpentyl)-3-oxocyclobutane-1-carboxamide.
| Compound Name | N-(4-hydroxy-2-phenylpentyl)-3-oxocyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 110004037 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-(4-hydroxy-2-phenylpentyl)-3-oxocyclobutane-1-carboxamide |
| SMILES | CC(O)CC(CNC(=O)C1CC(=O)C1)c1ccccc1 |
| InChI | InChI=1S/C16H21NO3/c1-11(18)7-14(12-5-3-2-4-6-12)10-17-16(20)13-8-15(19)9-13/h2-6,11,13-14,18H,7-10H2,1H3,(H,17,20) |
| InChIKey | GZCSKRVEIBSIDO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |