C15H22N2O3S — CID 174367190
tert-butyl N-(4-amino-3-hydroxy-2-phenyl-4-sulfanylidenebutyl)carbamate (PubChem CID 174367190) has the molecular formula C15H22N2O3S and a molecular weight of 310.42 g/mol. Its IUPAC name is tert-butyl N-(4-amino-3-hydroxy-2-phenyl-4-sulfanylidenebutyl)carbamate.
| Compound Name | tert-butyl N-(4-amino-3-hydroxy-2-phenyl-4-sulfanylidenebutyl)carbamate |
|---|---|
| PubChem CID | 174367190 |
| Molecular Formula | C15H22N2O3S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | tert-butyl N-(4-amino-3-hydroxy-2-phenyl-4-sulfanylidenebutyl)carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(c1ccccc1)C(O)C(N)=S |
| InChI | InChI=1S/C15H22N2O3S/c1-15(2,3)20-14(19)17-9-11(12(18)13(16)21)10-7-5-4-6-8-10/h4-8,11-12,18H,9H2,1-3H3,(H2,16,21)(H,17,19) |
| InChIKey | FECKMCVHJDGTQA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|