C16H23IN2O4 — CID 174404191
tert-butyl N-[3-carbamoyloxy-2-(iodomethyl)-3-phenylpropyl]carbamate (PubChem CID 174404191) has the molecular formula C16H23IN2O4 and a molecular weight of 434.27 g/mol. Its IUPAC name is tert-butyl N-[3-carbamoyloxy-2-(iodomethyl)-3-phenylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-carbamoyloxy-2-(iodomethyl)-3-phenylpropyl]carbamate |
|---|---|
| PubChem CID | 174404191 |
| Molecular Formula | C16H23IN2O4 |
| Molecular Weight | 434.27 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | tert-butyl N-[3-carbamoyloxy-2-(iodomethyl)-3-phenylpropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(CI)C(OC(N)=O)c1ccccc1 |
| InChI | InChI=1S/C16H23IN2O4/c1-16(2,3)23-15(21)19-10-12(9-17)13(22-14(18)20)11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3,(H2,18,20)(H,19,21) |
| InChIKey | JOXUKDYUNQGDSW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|