C17H25NO3 — CID 102420533
tert-butyl N-[(1S,3S)-3-hydroxy-1-phenylhex-5-enyl]carbamate (PubChem CID 102420533) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is tert-butyl N-[(1S,3S)-3-hydroxy-1-phenylhex-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(1S,3S)-3-hydroxy-1-phenylhex-5-enyl]carbamate |
|---|---|
| PubChem CID | 102420533 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | tert-butyl N-[(1S,3S)-3-hydroxy-1-phenylhex-5-enyl]carbamate |
| SMILES | C=CC[C@H](O)C[C@H](NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-5-9-14(19)12-15(13-10-7-6-8-11-13)18-16(20)21-17(2,3)4/h5-8,10-11,14-15,19H,1,9,12H2,2-4H3,(H,18,20)/t14-,15-/m0/s1 |
| InChIKey | UFVQTHBJBSLFPG-GJZGRUSLSA-N |
| XLogP | 3.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|