C18H25NO2 — CID 101201428
tert-butyl N-[(4E)-1-phenylhepta-4,6-dienyl]carbamate (PubChem CID 101201428) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is tert-butyl N-[(4E)-1-phenylhepta-4,6-dienyl]carbamate.
| Compound Name | tert-butyl N-[(4E)-1-phenylhepta-4,6-dienyl]carbamate |
|---|---|
| PubChem CID | 101201428 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | tert-butyl N-[(4E)-1-phenylhepta-4,6-dienyl]carbamate |
| SMILES | C=C/C=C/CCC(NC(=O)OC(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C18H25NO2/c1-5-6-7-11-14-16(15-12-9-8-10-13-15)19-17(20)21-18(2,3)4/h5-10,12-13,16H,1,11,14H2,2-4H3,(H,19,20)/b7-6+ |
| InChIKey | UGQKQLIKLUBPEE-VOTSOKGWSA-N |
| XLogP | 4.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|