C24H29NO4 — CID 102420534
tert-butyl N-[(E,1S,3S)-3-hydroxy-7-oxo-1,7-diphenylhept-5-enyl]carbamate (PubChem CID 102420534) has the molecular formula C24H29NO4 and a molecular weight of 395.50 g/mol. Its IUPAC name is tert-butyl N-[(E,1S,3S)-3-hydroxy-7-oxo-1,7-diphenylhept-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(E,1S,3S)-3-hydroxy-7-oxo-1,7-diphenylhept-5-enyl]carbamate |
|---|---|
| PubChem CID | 102420534 |
| Molecular Formula | C24H29NO4 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | tert-butyl N-[(E,1S,3S)-3-hydroxy-7-oxo-1,7-diphenylhept-5-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C[C@@H](O)C/C=C/C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H29NO4/c1-24(2,3)29-23(28)25-21(18-11-6-4-7-12-18)17-20(26)15-10-16-22(27)19-13-8-5-9-14-19/h4-14,16,20-21,26H,15,17H2,1-3H3,(H,25,28)/b16-10+/t20-,21-/m0/s1 |
| InChIKey | KQEVEYUYDWVTJK-IMRNQXLRSA-N |
| XLogP | 4.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|