About ethyl 2-methylbutanoate;styrene
ethyl 2-methylbutanoate;styrene (PubChem CID 91021086) has the molecular formula C15H22O2
and a molecular weight of 234.34 g/mol. Its IUPAC name is ethyl 2-methylbutanoate;styrene.
Molecular Properties
| Compound Name | ethyl 2-methylbutanoate;styrene |
| PubChem CID | 91021086 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | ethyl 2-methylbutanoate;styrene |
| SMILES | C=Cc1ccccc1.CCOC(=O)C(C)CC |
| InChI | InChI=1S/C8H8.C7H14O2/c1-2-8-6-4-3-5-7-8;1-4-6(3)7(8)9-5-2/h2-7H,1H2;6H,4-5H2,1-3H3 |
| InChIKey | WOOVSELTKCAZNI-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl 2-methylbutanoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methylbutanoate;styrene?
The IUPAC name of ethyl 2-methylbutanoate;styrene (CID 91021086) is ethyl 2-methylbutanoate;styrene.
What is the SMILES notation for ethyl 2-methylbutanoate;styrene?
The canonical SMILES for ethyl 2-methylbutanoate;styrene is C=Cc1ccccc1.CCOC(=O)C(C)CC.
What is the InChIKey of ethyl 2-methylbutanoate;styrene?
The InChIKey is WOOVSELTKCAZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C7H14O2/c1-2-8-6-4-3-5-7-8;1-4-6(3)7(8)9-5-2/h2-7H,1H2;6H,4-5H2,1-3H3.
What are the key properties of ethyl 2-methylbutanoate;styrene?
ethyl 2-methylbutanoate;styrene has a molecular weight of 234.34 g/mol, XLogP of 3.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methylbutanoate;styrene is sourced from PubChem (CID 91021086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).