About ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate
ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate (PubChem CID 175450958) has the molecular formula C12H24O5
and a molecular weight of 248.32 g/mol. Its IUPAC name is ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate.
Molecular Properties
| Compound Name | ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate |
| PubChem CID | 175450958 |
| Molecular Formula | C12H24O5 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate |
| SMILES | CCOC(=O)C(C)CC.CCOC(=O)C(C)O |
| InChI | InChI=1S/C7H14O2.C5H10O3/c1-4-6(3)7(8)9-5-2;1-3-8-5(7)4(2)6/h6H,4-5H2,1-3H3;4,6H,3H2,1-2H3 |
| InChIKey | KZCHDFOFHPRLNX-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate?
The IUPAC name of ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate (CID 175450958) is ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate.
What is the SMILES notation for ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate?
The canonical SMILES for ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate is CCOC(=O)C(C)CC.CCOC(=O)C(C)O.
What is the InChIKey of ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate?
The InChIKey is KZCHDFOFHPRLNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.C5H10O3/c1-4-6(3)7(8)9-5-2;1-3-8-5(7)4(2)6/h6H,4-5H2,1-3H3;4,6H,3H2,1-2H3.
What are the key properties of ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate?
ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate has a molecular weight of 248.32 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxypropanoate;ethyl 2-methylbutanoate is sourced from PubChem (CID 175450958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).