ethyl 2-hydroxypropanoate;2-fluoroacetic acid

C7H13FO5 — CID 174849871

IUPACethyl 2-hydroxypropanoate;2-fluoroacetic acid
SMILESCCOC(=O)C(C)O.O=C(O)CF
InChIInChI=1S/C5H10O3.C2H3FO2/c1-3-8-5(7)4(2)6;3-1-2(4)5/h4,6H,3H2,1-2H3;1H2,(H,4,5)
InChIKeyNHYPVNRFKKGHQZ-UHFFFAOYSA-N
MW196.17 g/mol
LogP-0.03
Rot. Bonds3

About ethyl 2-hydroxypropanoate;2-fluoroacetic acid

ethyl 2-hydroxypropanoate;2-fluoroacetic acid (PubChem CID 174849871) has the molecular formula C7H13FO5 and a molecular weight of 196.17 g/mol. Its IUPAC name is ethyl 2-hydroxypropanoate;2-fluoroacetic acid.

Molecular Properties

Compound Nameethyl 2-hydroxypropanoate;2-fluoroacetic acid
PubChem CID174849871
Molecular FormulaC7H13FO5
Molecular Weight196.17 g/mol
Exact Mass196.07
IUPAC Nameethyl 2-hydroxypropanoate;2-fluoroacetic acid
SMILESCCOC(=O)C(C)O.O=C(O)CF
InChIInChI=1S/C5H10O3.C2H3FO2/c1-3-8-5(7)4(2)6;3-1-2(4)5/h4,6H,3H2,1-2H3;1H2,(H,4,5)
InChIKeyNHYPVNRFKKGHQZ-UHFFFAOYSA-N
XLogP-0.03
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500196.17
LogP ≤ 5-0.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze ethyl 2-hydroxypropanoate;2-fluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-hydroxypropanoate;2-fluoroacetic acid?
The IUPAC name of ethyl 2-hydroxypropanoate;2-fluoroacetic acid (CID 174849871) is ethyl 2-hydroxypropanoate;2-fluoroacetic acid.
What is the SMILES notation for ethyl 2-hydroxypropanoate;2-fluoroacetic acid?
The canonical SMILES for ethyl 2-hydroxypropanoate;2-fluoroacetic acid is CCOC(=O)C(C)O.O=C(O)CF.
What is the InChIKey of ethyl 2-hydroxypropanoate;2-fluoroacetic acid?
The InChIKey is NHYPVNRFKKGHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O3.C2H3FO2/c1-3-8-5(7)4(2)6;3-1-2(4)5/h4,6H,3H2,1-2H3;1H2,(H,4,5).
What are the key properties of ethyl 2-hydroxypropanoate;2-fluoroacetic acid?
ethyl 2-hydroxypropanoate;2-fluoroacetic acid has a molecular weight of 196.17 g/mol, XLogP of -0.03, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxypropanoate;2-fluoroacetic acid is sourced from PubChem (CID 174849871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).