ethyl 2-hydroxypropanoate;hexanoic acid

C11H22O5 — CID 175216225

IUPACethyl 2-hydroxypropanoate;hexanoic acid
SMILESCCCCCC(=O)O.CCOC(=O)C(C)O
InChIInChI=1S/C6H12O2.C5H10O3/c1-2-3-4-5-6(7)8;1-3-8-5(7)4(2)6/h2-5H2,1H3,(H,7,8);4,6H,3H2,1-2H3
InChIKeyHUGDJZFOYXRUAG-UHFFFAOYSA-N
MW234.29 g/mol
LogP1.58
Rot. Bonds6

About ethyl 2-hydroxypropanoate;hexanoic acid

ethyl 2-hydroxypropanoate;hexanoic acid (PubChem CID 175216225) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is ethyl 2-hydroxypropanoate;hexanoic acid.

Molecular Properties

Compound Nameethyl 2-hydroxypropanoate;hexanoic acid
PubChem CID175216225
Molecular FormulaC11H22O5
Molecular Weight234.29 g/mol
Exact Mass234.15
IUPAC Nameethyl 2-hydroxypropanoate;hexanoic acid
SMILESCCCCCC(=O)O.CCOC(=O)C(C)O
InChIInChI=1S/C6H12O2.C5H10O3/c1-2-3-4-5-6(7)8;1-3-8-5(7)4(2)6/h2-5H2,1H3,(H,7,8);4,6H,3H2,1-2H3
InChIKeyHUGDJZFOYXRUAG-UHFFFAOYSA-N
XLogP1.58
TPSA83.83 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.29
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze ethyl 2-hydroxypropanoate;hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2-hydroxypropanoate;hexanoic acid?
The IUPAC name of ethyl 2-hydroxypropanoate;hexanoic acid (CID 175216225) is ethyl 2-hydroxypropanoate;hexanoic acid.
What is the SMILES notation for ethyl 2-hydroxypropanoate;hexanoic acid?
The canonical SMILES for ethyl 2-hydroxypropanoate;hexanoic acid is CCCCCC(=O)O.CCOC(=O)C(C)O.
What is the InChIKey of ethyl 2-hydroxypropanoate;hexanoic acid?
The InChIKey is HUGDJZFOYXRUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C5H10O3/c1-2-3-4-5-6(7)8;1-3-8-5(7)4(2)6/h2-5H2,1H3,(H,7,8);4,6H,3H2,1-2H3.
What are the key properties of ethyl 2-hydroxypropanoate;hexanoic acid?
ethyl 2-hydroxypropanoate;hexanoic acid has a molecular weight of 234.29 g/mol, XLogP of 1.58, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxypropanoate;hexanoic acid is sourced from PubChem (CID 175216225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).