ethyl 3-hydroxybutanoate;hexanedioic acid

C12H22O7 — CID 175499749

IUPACethyl 3-hydroxybutanoate;hexanedioic acid
SMILESCCOC(=O)CC(C)O.O=C(O)CCCCC(=O)O
InChIInChI=1S/C6H10O4.C6H12O3/c7-5(8)3-1-2-4-6(9)10;1-3-9-6(8)4-5(2)7/h1-4H2,(H,7,8)(H,9,10);5,7H,3-4H2,1-2H3
InChIKeyAXPXRBKHIKPJKG-UHFFFAOYSA-N
MW278.30 g/mol
LogP1.04
Rot. Bonds8

About ethyl 3-hydroxybutanoate;hexanedioic acid

ethyl 3-hydroxybutanoate;hexanedioic acid (PubChem CID 175499749) has the molecular formula C12H22O7 and a molecular weight of 278.30 g/mol. Its IUPAC name is ethyl 3-hydroxybutanoate;hexanedioic acid.

Molecular Properties

Compound Nameethyl 3-hydroxybutanoate;hexanedioic acid
PubChem CID175499749
Molecular FormulaC12H22O7
Molecular Weight278.30 g/mol
Exact Mass278.14
IUPAC Nameethyl 3-hydroxybutanoate;hexanedioic acid
SMILESCCOC(=O)CC(C)O.O=C(O)CCCCC(=O)O
InChIInChI=1S/C6H10O4.C6H12O3/c7-5(8)3-1-2-4-6(9)10;1-3-9-6(8)4-5(2)7/h1-4H2,(H,7,8)(H,9,10);5,7H,3-4H2,1-2H3
InChIKeyAXPXRBKHIKPJKG-UHFFFAOYSA-N
XLogP1.04
TPSA121.13 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds8
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.30
LogP ≤ 51.04
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze ethyl 3-hydroxybutanoate;hexanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3-hydroxybutanoate;hexanedioic acid?
The IUPAC name of ethyl 3-hydroxybutanoate;hexanedioic acid (CID 175499749) is ethyl 3-hydroxybutanoate;hexanedioic acid.
What is the SMILES notation for ethyl 3-hydroxybutanoate;hexanedioic acid?
The canonical SMILES for ethyl 3-hydroxybutanoate;hexanedioic acid is CCOC(=O)CC(C)O.O=C(O)CCCCC(=O)O.
What is the InChIKey of ethyl 3-hydroxybutanoate;hexanedioic acid?
The InChIKey is AXPXRBKHIKPJKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4.C6H12O3/c7-5(8)3-1-2-4-6(9)10;1-3-9-6(8)4-5(2)7/h1-4H2,(H,7,8)(H,9,10);5,7H,3-4H2,1-2H3.
What are the key properties of ethyl 3-hydroxybutanoate;hexanedioic acid?
ethyl 3-hydroxybutanoate;hexanedioic acid has a molecular weight of 278.30 g/mol, XLogP of 1.04, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxybutanoate;hexanedioic acid is sourced from PubChem (CID 175499749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).