C12H20O10 — CID 175499793
ethyl 3-hydroxybutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 175499793) has the molecular formula C12H20O10 and a molecular weight of 324.28 g/mol. Its IUPAC name is ethyl 3-hydroxybutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | ethyl 3-hydroxybutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 175499793 |
| Molecular Formula | C12H20O10 |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | ethyl 3-hydroxybutanoate;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCOC(=O)CC(C)O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.C6H12O3/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-3-9-6(8)4-5(2)7/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);5,7H,3-4H2,1-2H3 |
| InChIKey | MEJXUNYCRIAGGO-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |