C10H16O7 — CID 175499703
2-(4-ethoxy-4-oxobutan-2-yl)-2-hydroxybutanedioic acid (PubChem CID 175499703) has the molecular formula C10H16O7 and a molecular weight of 248.23 g/mol. Its IUPAC name is 2-(4-ethoxy-4-oxobutan-2-yl)-2-hydroxybutanedioic acid.
| Compound Name | 2-(4-ethoxy-4-oxobutan-2-yl)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 175499703 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 2-(4-ethoxy-4-oxobutan-2-yl)-2-hydroxybutanedioic acid |
| SMILES | CCOC(=O)CC(C)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16O7/c1-3-17-8(13)4-6(2)10(16,9(14)15)5-7(11)12/h6,16H,3-5H2,1-2H3,(H,11,12)(H,14,15) |
| InChIKey | BCTVZESFLOIDLP-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |