C18H28O13 — CID 129217962
propane-1,2,3-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 129217962) has the molecular formula C18H28O13 and a molecular weight of 452.41 g/mol. Its IUPAC name is propane-1,2,3-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | propane-1,2,3-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 129217962 |
| Molecular Formula | C18H28O13 |
| Molecular Weight | 452.41 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | propane-1,2,3-tricarboxylic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC.O=C(O)CC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H20O7.C6H8O6/c1-4-17-9(13)7-12(16,11(15)19-6-3)8-10(14)18-5-2;7-4(8)1-3(6(11)12)2-5(9)10/h16H,4-8H2,1-3H3;3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | NVMRFNQJYRMWAY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 211.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.41 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|