C30H54O9 — CID 173077615
octadec-9-enoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 173077615) has the molecular formula C30H54O9 and a molecular weight of 558.75 g/mol. Its IUPAC name is octadec-9-enoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | octadec-9-enoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 173077615 |
| Molecular Formula | C30H54O9 |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | octadec-9-enoic acid;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)O.CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C18H34O2.C12H20O7/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-17-9(13)7-12(16,11(15)19-6-3)8-10(14)18-5-2/h9-10H,2-8,11-17H2,1H3,(H,19,20);16H,4-8H2,1-3H3 |
| InChIKey | CIUMMGQWKUBPCF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|