C14H24O8 — CID 174945100
ethenol;triethyl 2-hydroxypropane-1,2,3-tricarboxylate (PubChem CID 174945100) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is ethenol;triethyl 2-hydroxypropane-1,2,3-tricarboxylate.
| Compound Name | ethenol;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 174945100 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | ethenol;triethyl 2-hydroxypropane-1,2,3-tricarboxylate |
| SMILES | C=CO.CCOC(=O)CC(O)(CC(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C12H20O7.C2H4O/c1-4-17-9(13)7-12(16,11(15)19-6-3)8-10(14)18-5-2;1-2-3/h16H,4-8H2,1-3H3;2-3H,1H2 |
| InChIKey | ZSFNODSSKOADOV-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|