C10H16O7Zr — CID 87337865
4-ethoxy-2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-oxobutanoic acid;zirconium (PubChem CID 87337865) has the molecular formula C10H16O7Zr and a molecular weight of 339.46 g/mol. Its IUPAC name is 4-ethoxy-2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-oxobutanoic acid;zirconium.
| Compound Name | 4-ethoxy-2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-oxobutanoic acid;zirconium |
|---|---|
| PubChem CID | 87337865 |
| Molecular Formula | C10H16O7Zr |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 4-ethoxy-2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-oxobutanoic acid;zirconium |
| SMILES | CCOC(=O)CC(O)(CC(=O)OCC)C(=O)O.[Zr] |
| InChI | InChI=1S/C10H16O7.Zr/c1-3-16-7(11)5-10(15,9(13)14)6-8(12)17-4-2;/h15H,3-6H2,1-2H3,(H,13,14); |
| InChIKey | QKQAIBHVHXCWGW-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |