C14H24O8 — CID 57107396
2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-(6-hydroxyhexoxy)-4-oxobutanoic acid (PubChem CID 57107396) has the molecular formula C14H24O8 and a molecular weight of 320.34 g/mol. Its IUPAC name is 2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-(6-hydroxyhexoxy)-4-oxobutanoic acid.
| Compound Name | 2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-(6-hydroxyhexoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 57107396 |
| Molecular Formula | C14H24O8 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | 2-(2-ethoxy-2-oxoethyl)-2-hydroxy-4-(6-hydroxyhexoxy)-4-oxobutanoic acid |
| SMILES | CCOC(=O)CC(O)(CC(=O)OCCCCCCO)C(=O)O |
| InChI | InChI=1S/C14H24O8/c1-2-21-11(16)9-14(20,13(18)19)10-12(17)22-8-6-4-3-5-7-15/h15,20H,2-10H2,1H3,(H,18,19) |
| InChIKey | KHEDNALXYLMENK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|