C9H14O8 — CID 54268654
2-hydroxy-2-[2-(3-hydroxypropoxy)-2-oxoethyl]butanedioic acid (PubChem CID 54268654) has the molecular formula C9H14O8 and a molecular weight of 250.20 g/mol. Its IUPAC name is 2-hydroxy-2-[2-(3-hydroxypropoxy)-2-oxoethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-(3-hydroxypropoxy)-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 54268654 |
| Molecular Formula | C9H14O8 |
| Molecular Weight | 250.20 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 2-hydroxy-2-[2-(3-hydroxypropoxy)-2-oxoethyl]butanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OCCCO)C(=O)O |
| InChI | InChI=1S/C9H14O8/c10-2-1-3-17-7(13)5-9(16,8(14)15)4-6(11)12/h10,16H,1-5H2,(H,11,12)(H,14,15) |
| InChIKey | RIOVKTSMNGOTTH-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.20 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|