C16H22O15 — CID 166905224
2-[2-[2-[3-(carboxymethyl)-3-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoyl]oxyethoxy]-2-oxoethyl]-2-hydroxybutanedioic acid (PubChem CID 166905224) has the molecular formula C16H22O15 and a molecular weight of 454.34 g/mol. Its IUPAC name is 2-[2-[2-[3-(carboxymethyl)-3-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoyl]oxyethoxy]-2-oxoethyl]-2-hydroxybutanedioic acid.
| Compound Name | 2-[2-[2-[3-(carboxymethyl)-3-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoyl]oxyethoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 166905224 |
| Molecular Formula | C16H22O15 |
| Molecular Weight | 454.34 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | 2-[2-[2-[3-(carboxymethyl)-3-hydroxy-4-(2-hydroxyethoxy)-4-oxobutanoyl]oxyethoxy]-2-oxoethyl]-2-hydroxybutanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OCCOC(=O)CC(O)(CC(=O)O)C(=O)OCCO)C(=O)O |
| InChI | InChI=1S/C16H22O15/c17-1-2-31-14(26)16(28,6-10(20)21)8-12(23)30-4-3-29-11(22)7-15(27,13(24)25)5-9(18)19/h17,27-28H,1-8H2,(H,18,19)(H,20,21)(H,24,25) |
| InChIKey | ZICKWTNJDGRKEH-UHFFFAOYSA-N |
| XLogP | -3.12 |
| TPSA | 251.49 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.34 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|