C11H16O8 — CID 152549811
2-hydroxy-2-[2-oxo-2-(2-prop-1-enoxyethoxy)ethyl]butanedioic acid (PubChem CID 152549811) has the molecular formula C11H16O8 and a molecular weight of 276.24 g/mol. Its IUPAC name is 2-hydroxy-2-[2-oxo-2-(2-prop-1-enoxyethoxy)ethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-oxo-2-(2-prop-1-enoxyethoxy)ethyl]butanedioic acid |
|---|---|
| PubChem CID | 152549811 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-hydroxy-2-[2-oxo-2-(2-prop-1-enoxyethoxy)ethyl]butanedioic acid |
| SMILES | CC=COCCOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H16O8/c1-2-3-18-4-5-19-9(14)7-11(17,10(15)16)6-8(12)13/h2-3,17H,4-7H2,1H3,(H,12,13)(H,15,16) |
| InChIKey | YNGFJUNXJDDLHU-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|