C10H18O7 — CID 173074280
ethane;2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid (PubChem CID 173074280) has the molecular formula C10H18O7 and a molecular weight of 250.25 g/mol. Its IUPAC name is ethane;2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid.
| Compound Name | ethane;2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid |
|---|---|
| PubChem CID | 173074280 |
| Molecular Formula | C10H18O7 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | ethane;2-(2-ethoxy-2-oxoethyl)-2-hydroxybutanedioic acid |
| SMILES | CC.CCOC(=O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C8H12O7.C2H6/c1-2-15-6(11)4-8(14,7(12)13)3-5(9)10;1-2/h14H,2-4H2,1H3,(H,9,10)(H,12,13);1-2H3 |
| InChIKey | CYGQJNPGFNMJGJ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |