C10H16O8 — CID 87726394
2-hydroxy-2-[2-(4-hydroxybutoxy)-2-oxoethyl]butanedioic acid (PubChem CID 87726394) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is 2-hydroxy-2-[2-(4-hydroxybutoxy)-2-oxoethyl]butanedioic acid.
| Compound Name | 2-hydroxy-2-[2-(4-hydroxybutoxy)-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 87726394 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-hydroxy-2-[2-(4-hydroxybutoxy)-2-oxoethyl]butanedioic acid |
| SMILES | O=C(O)CC(O)(CC(=O)OCCCCO)C(=O)O |
| InChI | InChI=1S/C10H16O8/c11-3-1-2-4-18-8(14)6-10(17,9(15)16)5-7(12)13/h11,17H,1-6H2,(H,12,13)(H,15,16) |
| InChIKey | DKWDFQWHQXZNBO-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|