C12H20O7 — CID 57202719
2-hydroxy-4-oxo-2-(2-oxo-2-propoxyethyl)-4-propoxybutanoic acid (PubChem CID 57202719) has the molecular formula C12H20O7 and a molecular weight of 276.28 g/mol. Its IUPAC name is 2-hydroxy-4-oxo-2-(2-oxo-2-propoxyethyl)-4-propoxybutanoic acid.
| Compound Name | 2-hydroxy-4-oxo-2-(2-oxo-2-propoxyethyl)-4-propoxybutanoic acid |
|---|---|
| PubChem CID | 57202719 |
| Molecular Formula | C12H20O7 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 2-hydroxy-4-oxo-2-(2-oxo-2-propoxyethyl)-4-propoxybutanoic acid |
| SMILES | CCCOC(=O)CC(O)(CC(=O)OCCC)C(=O)O |
| InChI | InChI=1S/C12H20O7/c1-3-5-18-9(13)7-12(17,11(15)16)8-10(14)19-6-4-2/h17H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | XSUPXKHTYKPZKM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |