C8H16O6 — CID 160553867
ethane-1,1-diol;hexanedioic acid (PubChem CID 160553867) has the molecular formula C8H16O6 and a molecular weight of 208.21 g/mol. Its IUPAC name is ethane-1,1-diol;hexanedioic acid.
| Compound Name | ethane-1,1-diol;hexanedioic acid |
|---|---|
| PubChem CID | 160553867 |
| Molecular Formula | C8H16O6 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | ethane-1,1-diol;hexanedioic acid |
| SMILES | CC(O)O.O=C(O)CCCCC(=O)O |
| InChI | InChI=1S/C6H10O4.C2H6O2/c7-5(8)3-1-2-4-6(9)10;1-2(3)4/h1-4H2,(H,7,8)(H,9,10);2-4H,1H3 |
| InChIKey | QYKQFIXDZBDELX-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|