About ethyl octanoate;octanoic acid
ethyl octanoate;octanoic acid (PubChem CID 18625122) has the molecular formula C18H36O4
and a molecular weight of 316.48 g/mol. Its IUPAC name is ethyl octanoate;octanoic acid.
Molecular Properties
| Compound Name | ethyl octanoate;octanoic acid |
| PubChem CID | 18625122 |
| Molecular Formula | C18H36O4 |
| Molecular Weight | 316.48 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | ethyl octanoate;octanoic acid |
| SMILES | CCCCCCCC(=O)O.CCCCCCCC(=O)OCC |
| InChI | InChI=1S/C10H20O2.C8H16O2/c1-3-5-6-7-8-9-10(11)12-4-2;1-2-3-4-5-6-7-8(9)10/h3-9H2,1-2H3;2-7H2,1H3,(H,9,10) |
| InChIKey | MLBOSDDUMKFYAP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.48 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl octanoate;octanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl octanoate;octanoic acid?
The IUPAC name of ethyl octanoate;octanoic acid (CID 18625122) is ethyl octanoate;octanoic acid.
What is the SMILES notation for ethyl octanoate;octanoic acid?
The canonical SMILES for ethyl octanoate;octanoic acid is CCCCCCCC(=O)O.CCCCCCCC(=O)OCC.
What is the InChIKey of ethyl octanoate;octanoic acid?
The InChIKey is MLBOSDDUMKFYAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C8H16O2/c1-3-5-6-7-8-9-10(11)12-4-2;1-2-3-4-5-6-7-8(9)10/h3-9H2,1-2H3;2-7H2,1H3,(H,9,10).
What are the key properties of ethyl octanoate;octanoic acid?
ethyl octanoate;octanoic acid has a molecular weight of 316.48 g/mol, XLogP of 5.34, 13 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl octanoate;octanoic acid is sourced from PubChem (CID 18625122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).