About 1-chloropentane;7-ethoxy-7-oxoheptanoic acid
1-chloropentane;7-ethoxy-7-oxoheptanoic acid (PubChem CID 175129053) has the molecular formula C14H27ClO4
and a molecular weight of 294.82 g/mol. Its IUPAC name is 1-chloropentane;7-ethoxy-7-oxoheptanoic acid.
Molecular Properties
| Compound Name | 1-chloropentane;7-ethoxy-7-oxoheptanoic acid |
| PubChem CID | 175129053 |
| Molecular Formula | C14H27ClO4 |
| Molecular Weight | 294.82 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | 1-chloropentane;7-ethoxy-7-oxoheptanoic acid |
| SMILES | CCCCCCl.CCOC(=O)CCCCCC(=O)O |
| InChI | InChI=1S/C9H16O4.C5H11Cl/c1-2-13-9(12)7-5-3-4-6-8(10)11;1-2-3-4-5-6/h2-7H2,1H3,(H,10,11);2-5H2,1H3 |
| InChIKey | YZQCLNSLFLIBEX-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;7-ethoxy-7-oxoheptanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;7-ethoxy-7-oxoheptanoic acid?
The IUPAC name of 1-chloropentane;7-ethoxy-7-oxoheptanoic acid (CID 175129053) is 1-chloropentane;7-ethoxy-7-oxoheptanoic acid.
What is the SMILES notation for 1-chloropentane;7-ethoxy-7-oxoheptanoic acid?
The canonical SMILES for 1-chloropentane;7-ethoxy-7-oxoheptanoic acid is CCCCCCl.CCOC(=O)CCCCCC(=O)O.
What is the InChIKey of 1-chloropentane;7-ethoxy-7-oxoheptanoic acid?
The InChIKey is YZQCLNSLFLIBEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.C5H11Cl/c1-2-13-9(12)7-5-3-4-6-8(10)11;1-2-3-4-5-6/h2-7H2,1H3,(H,10,11);2-5H2,1H3.
What are the key properties of 1-chloropentane;7-ethoxy-7-oxoheptanoic acid?
1-chloropentane;7-ethoxy-7-oxoheptanoic acid has a molecular weight of 294.82 g/mol, XLogP of 4.00, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;7-ethoxy-7-oxoheptanoic acid is sourced from PubChem (CID 175129053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).