About 1-chloropentane;decanoic acid
1-chloropentane;decanoic acid (PubChem CID 174719935) has the molecular formula C15H31ClO2
and a molecular weight of 278.86 g/mol. Its IUPAC name is 1-chloropentane;decanoic acid.
Molecular Properties
| Compound Name | 1-chloropentane;decanoic acid |
| PubChem CID | 174719935 |
| Molecular Formula | C15H31ClO2 |
| Molecular Weight | 278.86 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 1-chloropentane;decanoic acid |
| SMILES | CCCCCCCCCC(=O)O.CCCCCCl |
| InChI | InChI=1S/C10H20O2.C5H11Cl/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6/h2-9H2,1H3,(H,11,12);2-5H2,1H3 |
| InChIKey | KXVCGGQEEMBLME-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.86 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;decanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;decanoic acid?
The IUPAC name of 1-chloropentane;decanoic acid (CID 174719935) is 1-chloropentane;decanoic acid.
What is the SMILES notation for 1-chloropentane;decanoic acid?
The canonical SMILES for 1-chloropentane;decanoic acid is CCCCCCCCCC(=O)O.CCCCCCl.
What is the InChIKey of 1-chloropentane;decanoic acid?
The InChIKey is KXVCGGQEEMBLME-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.C5H11Cl/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6/h2-9H2,1H3,(H,11,12);2-5H2,1H3.
What are the key properties of 1-chloropentane;decanoic acid?
1-chloropentane;decanoic acid has a molecular weight of 278.86 g/mol, XLogP of 5.63, 11 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;decanoic acid is sourced from PubChem (CID 174719935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).