About azane;ethyl 2-hydroxypropanoate;phenylmercury
azane;ethyl 2-hydroxypropanoate;phenylmercury (PubChem CID 174333864) has the molecular formula C11H18HgNO3
and a molecular weight of 412.86 g/mol. Its IUPAC name is azane;ethyl 2-hydroxypropanoate;phenylmercury.
Molecular Properties
| Compound Name | azane;ethyl 2-hydroxypropanoate;phenylmercury |
| PubChem CID | 174333864 |
| Molecular Formula | C11H18HgNO3 |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | azane;ethyl 2-hydroxypropanoate;phenylmercury |
| SMILES | CCOC(=O)C(C)O.N.[Hg]c1ccccc1 |
| InChI | InChI=1S/C6H5.C5H10O3.Hg.H3N/c1-2-4-6-5-3-1;1-3-8-5(7)4(2)6;;/h1-5H;4,6H,3H2,1-2H3;;1H3 |
| InChIKey | STAZZYBCYREOHC-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;ethyl 2-hydroxypropanoate;phenylmercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;ethyl 2-hydroxypropanoate;phenylmercury?
The IUPAC name of azane;ethyl 2-hydroxypropanoate;phenylmercury (CID 174333864) is azane;ethyl 2-hydroxypropanoate;phenylmercury.
What is the SMILES notation for azane;ethyl 2-hydroxypropanoate;phenylmercury?
The canonical SMILES for azane;ethyl 2-hydroxypropanoate;phenylmercury is CCOC(=O)C(C)O.N.[Hg]c1ccccc1.
What is the InChIKey of azane;ethyl 2-hydroxypropanoate;phenylmercury?
The InChIKey is STAZZYBCYREOHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.C5H10O3.Hg.H3N/c1-2-4-6-5-3-1;1-3-8-5(7)4(2)6;;/h1-5H;4,6H,3H2,1-2H3;;1H3.
What are the key properties of azane;ethyl 2-hydroxypropanoate;phenylmercury?
azane;ethyl 2-hydroxypropanoate;phenylmercury has a molecular weight of 412.86 g/mol, XLogP of 0.95, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;ethyl 2-hydroxypropanoate;phenylmercury is sourced from PubChem (CID 174333864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).