About 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury
2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury (PubChem CID 174297430) has the molecular formula C11H19HgN2O3
and a molecular weight of 427.87 g/mol. Its IUPAC name is 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury.
Molecular Properties
| Compound Name | 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury |
| PubChem CID | 174297430 |
| Molecular Formula | C11H19HgN2O3 |
| Molecular Weight | 427.87 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury |
| SMILES | CC(O)C(=O)OCCN.N.[Hg]c1ccccc1 |
| InChI | InChI=1S/C6H5.C5H11NO3.Hg.H3N/c1-2-4-6-5-3-1;1-4(7)5(8)9-3-2-6;;/h1-5H;4,7H,2-3,6H2,1H3;;1H3 |
| InChIKey | GMRTXSZPVGEBAN-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.87 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury?
The IUPAC name of 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury (CID 174297430) is 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury.
What is the SMILES notation for 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury?
The canonical SMILES for 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury is CC(O)C(=O)OCCN.N.[Hg]c1ccccc1.
What is the InChIKey of 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury?
The InChIKey is GMRTXSZPVGEBAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.C5H11NO3.Hg.H3N/c1-2-4-6-5-3-1;1-4(7)5(8)9-3-2-6;;/h1-5H;4,7H,2-3,6H2,1H3;;1H3.
What are the key properties of 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury?
2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury has a molecular weight of 427.87 g/mol, XLogP of -0.11, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl 2-hydroxypropanoate;azane;phenylmercury is sourced from PubChem (CID 174297430), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).