C29H48O7 — CID 139331739
diethyl benzene-1,2-dicarboxylate;tetradecyl 2-hydroxypropanoate (PubChem CID 139331739) has the molecular formula C29H48O7 and a molecular weight of 508.70 g/mol. Its IUPAC name is diethyl benzene-1,2-dicarboxylate;tetradecyl 2-hydroxypropanoate.
| Compound Name | diethyl benzene-1,2-dicarboxylate;tetradecyl 2-hydroxypropanoate |
|---|---|
| PubChem CID | 139331739 |
| Molecular Formula | C29H48O7 |
| Molecular Weight | 508.70 g/mol |
| Exact Mass | 508.34 |
| IUPAC Name | diethyl benzene-1,2-dicarboxylate;tetradecyl 2-hydroxypropanoate |
| SMILES | CCCCCCCCCCCCCCOC(=O)C(C)O.CCOC(=O)c1ccccc1C(=O)OCC |
| InChI | InChI=1S/C17H34O3.C12H14O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-20-17(19)16(2)18;1-3-15-11(13)9-7-5-6-8-10(9)12(14)16-4-2/h16,18H,3-15H2,1-2H3;5-8H,3-4H2,1-2H3 |
| InChIKey | IVVGBPZOGVXXPP-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|