About 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid
4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid (PubChem CID 155483536) has the molecular formula C16H23NO4
and a molecular weight of 293.36 g/mol. Its IUPAC name is 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid.
Molecular Properties
| Compound Name | 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid |
| PubChem CID | 155483536 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid |
| SMILES | CC(c1ccccc1)C(C(=O)O)C(C)(C)C(=O)OCCN |
| InChI | InChI=1S/C16H23NO4/c1-11(12-7-5-4-6-8-12)13(14(18)19)16(2,3)15(20)21-10-9-17/h4-8,11,13H,9-10,17H2,1-3H3,(H,18,19) |
| InChIKey | YVRXXPJQHLKDEJ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid?
The IUPAC name of 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid (CID 155483536) is 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid.
What is the SMILES notation for 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid?
The canonical SMILES for 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid is CC(c1ccccc1)C(C(=O)O)C(C)(C)C(=O)OCCN.
What is the InChIKey of 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid?
The InChIKey is YVRXXPJQHLKDEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23NO4/c1-11(12-7-5-4-6-8-12)13(14(18)19)16(2,3)15(20)21-10-9-17/h4-8,11,13H,9-10,17H2,1-3H3,(H,18,19).
What are the key properties of 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid?
4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid has a molecular weight of 293.36 g/mol, XLogP of 2.02, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-aminoethoxy)-3,3-dimethyl-4-oxo-2-(1-phenylethyl)butanoic acid is sourced from PubChem (CID 155483536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).