C15H22O4 — CID 118379236
[(3S,4S)-3,4-dihydroxy-4-phenylbutyl] 2,2-dimethylpropanoate (PubChem CID 118379236) has the molecular formula C15H22O4 and a molecular weight of 266.34 g/mol. Its IUPAC name is [(3S,4S)-3,4-dihydroxy-4-phenylbutyl] 2,2-dimethylpropanoate.
| Compound Name | [(3S,4S)-3,4-dihydroxy-4-phenylbutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118379236 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | [(3S,4S)-3,4-dihydroxy-4-phenylbutyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCC[C@H](O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C15H22O4/c1-15(2,3)14(18)19-10-9-12(16)13(17)11-7-5-4-6-8-11/h4-8,12-13,16-17H,9-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | PLPMWFAOHGYIPO-STQMWFEESA-N |
| XLogP | 2.06 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |