C16H23ClO4 — CID 90018911
[5-(2-chlorophenyl)-3,4-dihydroxypentyl] 2,2-dimethylpropanoate (PubChem CID 90018911) has the molecular formula C16H23ClO4 and a molecular weight of 314.81 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-3,4-dihydroxypentyl] 2,2-dimethylpropanoate.
| Compound Name | [5-(2-chlorophenyl)-3,4-dihydroxypentyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 90018911 |
| Molecular Formula | C16H23ClO4 |
| Molecular Weight | 314.81 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | [5-(2-chlorophenyl)-3,4-dihydroxypentyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCCC(O)C(O)Cc1ccccc1Cl |
| InChI | InChI=1S/C16H23ClO4/c1-16(2,3)15(20)21-9-8-13(18)14(19)10-11-6-4-5-7-12(11)17/h4-7,13-14,18-19H,8-10H2,1-3H3 |
| InChIKey | FRYFGKJHKMQHQA-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |