C21H33ClO4 — CID 144861702
[(3R,4S)-4-(2-chlorophenyl)-4-(3-hydroxypentan-3-yloxy)-3-methylbutyl] 2,2-dimethylpropanoate (PubChem CID 144861702) has the molecular formula C21H33ClO4 and a molecular weight of 384.94 g/mol. Its IUPAC name is [(3R,4S)-4-(2-chlorophenyl)-4-(3-hydroxypentan-3-yloxy)-3-methylbutyl] 2,2-dimethylpropanoate.
| Compound Name | [(3R,4S)-4-(2-chlorophenyl)-4-(3-hydroxypentan-3-yloxy)-3-methylbutyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 144861702 |
| Molecular Formula | C21H33ClO4 |
| Molecular Weight | 384.94 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | [(3R,4S)-4-(2-chlorophenyl)-4-(3-hydroxypentan-3-yloxy)-3-methylbutyl] 2,2-dimethylpropanoate |
| SMILES | CCC(O)(CC)O[C@H](c1ccccc1Cl)[C@H](C)CCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C21H33ClO4/c1-7-21(24,8-2)26-18(16-11-9-10-12-17(16)22)15(3)13-14-25-19(23)20(4,5)6/h9-12,15,18,24H,7-8,13-14H2,1-6H3/t15-,18+/m1/s1 |
| InChIKey | DBLFDTQIWHSXPT-QAPCUYQASA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.94 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|