C17H21ClO6 — CID 102417450
triethyl 2-(2-chlorophenyl)ethane-1,1,2-tricarboxylate (PubChem CID 102417450) has the molecular formula C17H21ClO6 and a molecular weight of 356.80 g/mol. Its IUPAC name is triethyl 2-(2-chlorophenyl)ethane-1,1,2-tricarboxylate.
| Compound Name | triethyl 2-(2-chlorophenyl)ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 102417450 |
| Molecular Formula | C17H21ClO6 |
| Molecular Weight | 356.80 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | triethyl 2-(2-chlorophenyl)ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C(=O)OCC)c1ccccc1Cl |
| InChI | InChI=1S/C17H21ClO6/c1-4-22-15(19)13(11-9-7-8-10-12(11)18)14(16(20)23-5-2)17(21)24-6-3/h7-10,13-14H,4-6H2,1-3H3 |
| InChIKey | IXXRFAJLZOSSBB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|