C20H25NO6 — CID 11696471
triethyl (2R)-2-(1-methylindol-3-yl)ethane-1,1,2-tricarboxylate (PubChem CID 11696471) has the molecular formula C20H25NO6 and a molecular weight of 375.42 g/mol. Its IUPAC name is triethyl (2R)-2-(1-methylindol-3-yl)ethane-1,1,2-tricarboxylate.
| Compound Name | triethyl (2R)-2-(1-methylindol-3-yl)ethane-1,1,2-tricarboxylate |
|---|---|
| PubChem CID | 11696471 |
| Molecular Formula | C20H25NO6 |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | triethyl (2R)-2-(1-methylindol-3-yl)ethane-1,1,2-tricarboxylate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H](C(=O)OCC)c1cn(C)c2ccccc12 |
| InChI | InChI=1S/C20H25NO6/c1-5-25-18(22)16(17(19(23)26-6-2)20(24)27-7-3)14-12-21(4)15-11-9-8-10-13(14)15/h8-12,16-17H,5-7H2,1-4H3/t16-/m0/s1 |
| InChIKey | DUXDEFRKDLWOOC-INIZCTEOSA-N |
| XLogP | 2.57 |
| TPSA | 83.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|