C14H16Cl2O5 — CID 62393511
diethyl 2-[(2,6-dichlorophenyl)-hydroxymethyl]propanedioate (PubChem CID 62393511) has the molecular formula C14H16Cl2O5 and a molecular weight of 335.18 g/mol. Its IUPAC name is diethyl 2-[(2,6-dichlorophenyl)-hydroxymethyl]propanedioate.
| Compound Name | diethyl 2-[(2,6-dichlorophenyl)-hydroxymethyl]propanedioate |
|---|---|
| PubChem CID | 62393511 |
| Molecular Formula | C14H16Cl2O5 |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | diethyl 2-[(2,6-dichlorophenyl)-hydroxymethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C14H16Cl2O5/c1-3-20-13(18)11(14(19)21-4-2)12(17)10-8(15)6-5-7-9(10)16/h5-7,11-12,17H,3-4H2,1-2H3 |
| InChIKey | NSOCXCXZTKXUDB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|