C13H16Cl2N2O4 — CID 124926176
ethyl N-[(2,6-dichlorophenyl)-(ethoxycarbonylamino)methyl]carbamate (PubChem CID 124926176) has the molecular formula C13H16Cl2N2O4 and a molecular weight of 335.19 g/mol. Its IUPAC name is ethyl N-[(2,6-dichlorophenyl)-(ethoxycarbonylamino)methyl]carbamate.
| Compound Name | ethyl N-[(2,6-dichlorophenyl)-(ethoxycarbonylamino)methyl]carbamate |
|---|---|
| PubChem CID | 124926176 |
| Molecular Formula | C13H16Cl2N2O4 |
| Molecular Weight | 335.19 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | ethyl N-[(2,6-dichlorophenyl)-(ethoxycarbonylamino)methyl]carbamate |
| SMILES | CCOC(=O)NC(NC(=O)OCC)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O4/c1-3-20-12(18)16-11(17-13(19)21-4-2)10-8(14)6-5-7-9(10)15/h5-7,11H,3-4H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | GTICQQVJHIULAU-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.19 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|